C11H10FNO3 — CID 142674428
2-[2-(6-fluoro-2-pyridinyl)ethynyl]oxolane-3,4-diol (PubChem CID 142674428) has the molecular formula C11H10FNO3 and a molecular weight of 223.20 g/mol. Its IUPAC name is 2-[2-(6-fluoro-2-pyridinyl)ethynyl]oxolane-3,4-diol.
| Compound Name | 2-[2-(6-fluoro-2-pyridinyl)ethynyl]oxolane-3,4-diol |
|---|---|
| PubChem CID | 142674428 |
| Molecular Formula | C11H10FNO3 |
| Molecular Weight | 223.20 g/mol |
| Exact Mass | 223.06 |
| IUPAC Name | 2-[2-(6-fluoro-2-pyridinyl)ethynyl]oxolane-3,4-diol |
| SMILES | OC1COC(C#Cc2cccc(F)n2)C1O |
| InChI | InChI=1S/C11H10FNO3/c12-10-3-1-2-7(13-10)4-5-9-11(15)8(14)6-16-9/h1-3,8-9,11,14-15H,6H2 |
| InChIKey | VSYROOYKKGHBEA-UHFFFAOYSA-N |
| XLogP | -0.31 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 223.20 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|