C17H28F3NO3 — CID 178007843
ethane;2-methyl-6-(trifluoromethyl)pyridine;2-propyloxane-3,4-diol (PubChem CID 178007843) has the molecular formula C17H28F3NO3 and a molecular weight of 351.41 g/mol. Its IUPAC name is ethane;2-methyl-6-(trifluoromethyl)pyridine;2-propyloxane-3,4-diol.
| Compound Name | ethane;2-methyl-6-(trifluoromethyl)pyridine;2-propyloxane-3,4-diol |
|---|---|
| PubChem CID | 178007843 |
| Molecular Formula | C17H28F3NO3 |
| Molecular Weight | 351.41 g/mol |
| Exact Mass | 351.20 |
| IUPAC Name | ethane;2-methyl-6-(trifluoromethyl)pyridine;2-propyloxane-3,4-diol |
| SMILES | CC.CCCC1OCCC(O)C1O.Cc1cccc(C(F)(F)F)n1 |
| InChI | InChI=1S/C8H16O3.C7H6F3N.C2H6/c1-2-3-7-8(10)6(9)4-5-11-7;1-5-3-2-4-6(11-5)7(8,9)10;1-2/h6-10H,2-5H2,1H3;2-4H,1H3;1-2H3 |
| InChIKey | XIVAHUNLJMYBCP-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 62.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.41 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |