C31H46ClN3O5S — CID 142676934
4-butoxy-1-[[4-[4-[cyclohexylmethyl(methylsulfonyl)amino]phenoxy]phenyl]methyl]piperidine-4-carboxamide;hydrochloride (PubChem CID 142676934) has the molecular formula C31H46ClN3O5S and a molecular weight of 608.25 g/mol. Its IUPAC name is 4-butoxy-1-[[4-[4-[cyclohexylmethyl(methylsulfonyl)amino]phenoxy]phenyl]methyl]piperidine-4-carboxamide;hydrochloride.
| Compound Name | 4-butoxy-1-[[4-[4-[cyclohexylmethyl(methylsulfonyl)amino]phenoxy]phenyl]methyl]piperidine-4-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 142676934 |
| Molecular Formula | C31H46ClN3O5S |
| Molecular Weight | 608.25 g/mol |
| Exact Mass | 607.28 |
| IUPAC Name | 4-butoxy-1-[[4-[4-[cyclohexylmethyl(methylsulfonyl)amino]phenoxy]phenyl]methyl]piperidine-4-carboxamide;hydrochloride |
| SMILES | CCCCOC1(C(N)=O)CCN(Cc2ccc(Oc3ccc(N(CC4CCCCC4)S(C)(=O)=O)cc3)cc2)CC1.Cl |
| InChI | InChI=1S/C31H45N3O5S.ClH/c1-3-4-22-38-31(30(32)35)18-20-33(21-19-31)23-26-10-14-28(15-11-26)39-29-16-12-27(13-17-29)34(40(2,36)37)24-25-8-6-5-7-9-25;/h10-17,25H,3-9,18-24H2,1-2H3,(H2,32,35);1H |
| InChIKey | YKZPBKSBXQIGHX-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 102.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 608.25 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|