C19H10F3NOS — CID 142679335
4-[4-(1,3-benzothiazol-2-yl)-2,3,5-trifluorophenyl]phenol (PubChem CID 142679335) has the molecular formula C19H10F3NOS and a molecular weight of 357.36 g/mol. Its IUPAC name is 4-[4-(1,3-benzothiazol-2-yl)-2,3,5-trifluorophenyl]phenol.
| Compound Name | 4-[4-(1,3-benzothiazol-2-yl)-2,3,5-trifluorophenyl]phenol |
|---|---|
| PubChem CID | 142679335 |
| Molecular Formula | C19H10F3NOS |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.04 |
| IUPAC Name | 4-[4-(1,3-benzothiazol-2-yl)-2,3,5-trifluorophenyl]phenol |
| SMILES | Oc1ccc(-c2cc(F)c(-c3nc4ccccc4s3)c(F)c2F)cc1 |
| InChI | InChI=1S/C19H10F3NOS/c20-13-9-12(10-5-7-11(24)8-6-10)17(21)18(22)16(13)19-23-14-3-1-2-4-15(14)25-19/h1-9,24H |
| InChIKey | KFFCPMVNWGNPMT-UHFFFAOYSA-N |
| XLogP | 5.75 |
| TPSA | 33.12 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 5.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|