C24H19ClN6O4 — CID 142680082
methyl 5-[[4-[(4-anilino-6-chloro-1,3,5-triazin-2-yl)amino]benzoyl]amino]-2-hydroxybenzoate (PubChem CID 142680082) has the molecular formula C24H19ClN6O4 and a molecular weight of 490.91 g/mol. Its IUPAC name is methyl 5-[[4-[(4-anilino-6-chloro-1,3,5-triazin-2-yl)amino]benzoyl]amino]-2-hydroxybenzoate.
| Compound Name | methyl 5-[[4-[(4-anilino-6-chloro-1,3,5-triazin-2-yl)amino]benzoyl]amino]-2-hydroxybenzoate |
|---|---|
| PubChem CID | 142680082 |
| Molecular Formula | C24H19ClN6O4 |
| Molecular Weight | 490.91 g/mol |
| Exact Mass | 490.12 |
| IUPAC Name | methyl 5-[[4-[(4-anilino-6-chloro-1,3,5-triazin-2-yl)amino]benzoyl]amino]-2-hydroxybenzoate |
| SMILES | COC(=O)c1cc(NC(=O)c2ccc(Nc3nc(Cl)nc(Nc4ccccc4)n3)cc2)ccc1O |
| InChI | InChI=1S/C24H19ClN6O4/c1-35-21(34)18-13-17(11-12-19(18)32)26-20(33)14-7-9-16(10-8-14)28-24-30-22(25)29-23(31-24)27-15-5-3-2-4-6-15/h2-13,32H,1H3,(H,26,33)(H2,27,28,29,30,31) |
| InChIKey | YKALRTDSEARCTM-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 138.36 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.91 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|