C25H29ClFN5O2 — CID 142681719
N-[[2-amino-6-[5-[4-chloro-2-(fluoromethyl)anilino]-2-hydroxyphenyl]-3-pyridinyl]methyl]-2-(diethylamino)acetamide (PubChem CID 142681719) has the molecular formula C25H29ClFN5O2 and a molecular weight of 485.99 g/mol. Its IUPAC name is N-[[2-amino-6-[5-[4-chloro-2-(fluoromethyl)anilino]-2-hydroxyphenyl]-3-pyridinyl]methyl]-2-(diethylamino)acetamide.
| Compound Name | N-[[2-amino-6-[5-[4-chloro-2-(fluoromethyl)anilino]-2-hydroxyphenyl]-3-pyridinyl]methyl]-2-(diethylamino)acetamide |
|---|---|
| PubChem CID | 142681719 |
| Molecular Formula | C25H29ClFN5O2 |
| Molecular Weight | 485.99 g/mol |
| Exact Mass | 485.20 |
| IUPAC Name | N-[[2-amino-6-[5-[4-chloro-2-(fluoromethyl)anilino]-2-hydroxyphenyl]-3-pyridinyl]methyl]-2-(diethylamino)acetamide |
| SMILES | CCN(CC)CC(=O)NCc1ccc(-c2cc(Nc3ccc(Cl)cc3CF)ccc2O)nc1N |
| InChI | InChI=1S/C25H29ClFN5O2/c1-3-32(4-2)15-24(34)29-14-16-5-8-22(31-25(16)28)20-12-19(7-10-23(20)33)30-21-9-6-18(26)11-17(21)13-27/h5-12,30,33H,3-4,13-15H2,1-2H3,(H2,28,31)(H,29,34) |
| InChIKey | HCGRZAHKZZAJBC-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 103.51 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.99 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|