C24H25NO9 — CID 142681880
[4-(5-hydroxy-6-methoxy-4-oxo-7-propanoyloxychromen-2-yl)oxyphenyl] 2-amino-3-methylbutanoate (PubChem CID 142681880) has the molecular formula C24H25NO9 and a molecular weight of 471.46 g/mol. Its IUPAC name is [4-(5-hydroxy-6-methoxy-4-oxo-7-propanoyloxychromen-2-yl)oxyphenyl] 2-amino-3-methylbutanoate.
| Compound Name | [4-(5-hydroxy-6-methoxy-4-oxo-7-propanoyloxychromen-2-yl)oxyphenyl] 2-amino-3-methylbutanoate |
|---|---|
| PubChem CID | 142681880 |
| Molecular Formula | C24H25NO9 |
| Molecular Weight | 471.46 g/mol |
| Exact Mass | 471.15 |
| IUPAC Name | [4-(5-hydroxy-6-methoxy-4-oxo-7-propanoyloxychromen-2-yl)oxyphenyl] 2-amino-3-methylbutanoate |
| SMILES | CCC(=O)Oc1cc2oc(Oc3ccc(OC(=O)C(N)C(C)C)cc3)cc(=O)c2c(O)c1OC |
| InChI | InChI=1S/C24H25NO9/c1-5-18(27)33-17-11-16-20(22(28)23(17)30-4)15(26)10-19(34-16)31-13-6-8-14(9-7-13)32-24(29)21(25)12(2)3/h6-12,21,28H,5,25H2,1-4H3 |
| InChIKey | GMPYSQRSPDZOEX-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 147.52 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.46 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|