C22H20O8 — CID 56596785
[9-oxo-6,7-di(propanoyloxy)xanthen-3-yl] propanoate (PubChem CID 56596785) has the molecular formula C22H20O8 and a molecular weight of 412.39 g/mol. Its IUPAC name is [9-oxo-6,7-di(propanoyloxy)xanthen-3-yl] propanoate.
| Compound Name | [9-oxo-6,7-di(propanoyloxy)xanthen-3-yl] propanoate |
|---|---|
| PubChem CID | 56596785 |
| Molecular Formula | C22H20O8 |
| Molecular Weight | 412.39 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | [9-oxo-6,7-di(propanoyloxy)xanthen-3-yl] propanoate |
| SMILES | CCC(=O)Oc1ccc2c(=O)c3cc(OC(=O)CC)c(OC(=O)CC)cc3oc2c1 |
| InChI | InChI=1S/C22H20O8/c1-4-19(23)27-12-7-8-13-15(9-12)28-16-11-18(30-21(25)6-3)17(29-20(24)5-2)10-14(16)22(13)26/h7-11H,4-6H2,1-3H3 |
| InChIKey | HERCKFLTZRLJGE-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 109.11 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.39 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|