C26H28F3N5O6 — CID 142682892
2-methyl-2-[4-[2-[[4-morpholin-4-yl-6-[4-(trifluoromethyl)anilino]-1,3,5-triazin-2-yl]oxy]ethoxy]phenoxy]propanoic acid (PubChem CID 142682892) has the molecular formula C26H28F3N5O6 and a molecular weight of 563.53 g/mol. Its IUPAC name is 2-methyl-2-[4-[2-[[4-morpholin-4-yl-6-[4-(trifluoromethyl)anilino]-1,3,5-triazin-2-yl]oxy]ethoxy]phenoxy]propanoic acid.
| Compound Name | 2-methyl-2-[4-[2-[[4-morpholin-4-yl-6-[4-(trifluoromethyl)anilino]-1,3,5-triazin-2-yl]oxy]ethoxy]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 142682892 |
| Molecular Formula | C26H28F3N5O6 |
| Molecular Weight | 563.53 g/mol |
| Exact Mass | 563.20 |
| IUPAC Name | 2-methyl-2-[4-[2-[[4-morpholin-4-yl-6-[4-(trifluoromethyl)anilino]-1,3,5-triazin-2-yl]oxy]ethoxy]phenoxy]propanoic acid |
| SMILES | CC(C)(Oc1ccc(OCCOc2nc(Nc3ccc(C(F)(F)F)cc3)nc(N3CCOCC3)n2)cc1)C(=O)O |
| InChI | InChI=1S/C26H28F3N5O6/c1-25(2,21(35)36)40-20-9-7-19(8-10-20)38-15-16-39-24-32-22(31-23(33-24)34-11-13-37-14-12-34)30-18-5-3-17(4-6-18)26(27,28)29/h3-10H,11-16H2,1-2H3,(H,35,36)(H,30,31,32,33) |
| InChIKey | RPIQAUXIGLWWLX-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 128.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.53 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|