C24H21Cl2NO6S — CID 142683718
(2S,3R)-2-[carboxymethyl-[4-(4-chlorophenyl)phenyl]sulfonylamino]-2-chloro-3-phenylbutanoic acid (PubChem CID 142683718) has the molecular formula C24H21Cl2NO6S and a molecular weight of 522.41 g/mol. Its IUPAC name is (2S,3R)-2-[carboxymethyl-[4-(4-chlorophenyl)phenyl]sulfonylamino]-2-chloro-3-phenylbutanoic acid.
| Compound Name | (2S,3R)-2-[carboxymethyl-[4-(4-chlorophenyl)phenyl]sulfonylamino]-2-chloro-3-phenylbutanoic acid |
|---|---|
| PubChem CID | 142683718 |
| Molecular Formula | C24H21Cl2NO6S |
| Molecular Weight | 522.41 g/mol |
| Exact Mass | 521.05 |
| IUPAC Name | (2S,3R)-2-[carboxymethyl-[4-(4-chlorophenyl)phenyl]sulfonylamino]-2-chloro-3-phenylbutanoic acid |
| SMILES | C[C@H](c1ccccc1)[C@](Cl)(C(=O)O)N(CC(=O)O)S(=O)(=O)c1ccc(-c2ccc(Cl)cc2)cc1 |
| InChI | InChI=1S/C24H21Cl2NO6S/c1-16(17-5-3-2-4-6-17)24(26,23(30)31)27(15-22(28)29)34(32,33)21-13-9-19(10-14-21)18-7-11-20(25)12-8-18/h2-14,16H,15H2,1H3,(H,28,29)(H,30,31)/t16-,24-/m1/s1 |
| InChIKey | JVMAVIXHEAOJKN-VOIUYBSRSA-N |
| XLogP | 4.91 |
| TPSA | 111.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.41 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|