(3-benzylsulfanylphenoxy)boronic acid

C13H13BO3S — CID 142685074

IUPAC(3-benzylsulfanylphenoxy)boronic acid
SMILESOB(O)Oc1cccc(SCc2ccccc2)c1
InChIInChI=1S/C13H13BO3S/c15-14(16)17-12-7-4-8-13(9-12)18-10-11-5-2-1-3-6-11/h1-9,15-16H,10H2
InChIKeyJWIWNLIWIIBWRK-UHFFFAOYSA-N
MW260.12 g/mol
LogP2.33
Rot. Bonds5

About (3-benzylsulfanylphenoxy)boronic acid

(3-benzylsulfanylphenoxy)boronic acid (PubChem CID 142685074) has the molecular formula C13H13BO3S and a molecular weight of 260.12 g/mol. Its IUPAC name is (3-benzylsulfanylphenoxy)boronic acid.

Molecular Properties

Compound Name(3-benzylsulfanylphenoxy)boronic acid
PubChem CID142685074
Molecular FormulaC13H13BO3S
Molecular Weight260.12 g/mol
Exact Mass260.07
IUPAC Name(3-benzylsulfanylphenoxy)boronic acid
SMILESOB(O)Oc1cccc(SCc2ccccc2)c1
InChIInChI=1S/C13H13BO3S/c15-14(16)17-12-7-4-8-13(9-12)18-10-11-5-2-1-3-6-11/h1-9,15-16H,10H2
InChIKeyJWIWNLIWIIBWRK-UHFFFAOYSA-N
XLogP2.33
TPSA49.69 Ų
H-Bond Donors2
H-Bond Acceptors4
Rotatable Bonds5
Heavy Atoms18
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500260.12
LogP ≤ 52.33
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}

Analyze (3-benzylsulfanylphenoxy)boronic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3-benzylsulfanylphenoxy)boronic acid?
The IUPAC name of (3-benzylsulfanylphenoxy)boronic acid (CID 142685074) is (3-benzylsulfanylphenoxy)boronic acid.
What is the SMILES notation for (3-benzylsulfanylphenoxy)boronic acid?
The canonical SMILES for (3-benzylsulfanylphenoxy)boronic acid is OB(O)Oc1cccc(SCc2ccccc2)c1.
What is the InChIKey of (3-benzylsulfanylphenoxy)boronic acid?
The InChIKey is JWIWNLIWIIBWRK-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H13BO3S/c15-14(16)17-12-7-4-8-13(9-12)18-10-11-5-2-1-3-6-11/h1-9,15-16H,10H2.
What are the key properties of (3-benzylsulfanylphenoxy)boronic acid?
(3-benzylsulfanylphenoxy)boronic acid has a molecular weight of 260.12 g/mol, XLogP of 2.33, 5 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (3-benzylsulfanylphenoxy)boronic acid is sourced from PubChem (CID 142685074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).