C22H28FNO3S — CID 171804921
tert-butyl N-[2-(3-benzylsulfanylphenoxy)ethyl]-N-(2-fluoroethyl)carbamate (PubChem CID 171804921) has the molecular formula C22H28FNO3S and a molecular weight of 405.54 g/mol. Its IUPAC name is tert-butyl N-[2-(3-benzylsulfanylphenoxy)ethyl]-N-(2-fluoroethyl)carbamate.
| Compound Name | tert-butyl N-[2-(3-benzylsulfanylphenoxy)ethyl]-N-(2-fluoroethyl)carbamate |
|---|---|
| PubChem CID | 171804921 |
| Molecular Formula | C22H28FNO3S |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.18 |
| IUPAC Name | tert-butyl N-[2-(3-benzylsulfanylphenoxy)ethyl]-N-(2-fluoroethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(CCF)CCOc1cccc(SCc2ccccc2)c1 |
| InChI | InChI=1S/C22H28FNO3S/c1-22(2,3)27-21(25)24(13-12-23)14-15-26-19-10-7-11-20(16-19)28-17-18-8-5-4-6-9-18/h4-11,16H,12-15,17H2,1-3H3 |
| InChIKey | MKPFHRDVNUPNKE-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |