C25H33FN4O5 — CID 142686791
N-[(2R,4S)-2-butyl-4-[(5-fluoro-3-hydroxy-2-pyridinyl)carbamoylamino]-5-methyl-3-oxohexyl]-N-phenylmethoxyformamide (PubChem CID 142686791) has the molecular formula C25H33FN4O5 and a molecular weight of 488.56 g/mol. Its IUPAC name is N-[(2R,4S)-2-butyl-4-[(5-fluoro-3-hydroxy-2-pyridinyl)carbamoylamino]-5-methyl-3-oxohexyl]-N-phenylmethoxyformamide.
| Compound Name | N-[(2R,4S)-2-butyl-4-[(5-fluoro-3-hydroxy-2-pyridinyl)carbamoylamino]-5-methyl-3-oxohexyl]-N-phenylmethoxyformamide |
|---|---|
| PubChem CID | 142686791 |
| Molecular Formula | C25H33FN4O5 |
| Molecular Weight | 488.56 g/mol |
| Exact Mass | 488.24 |
| IUPAC Name | N-[(2R,4S)-2-butyl-4-[(5-fluoro-3-hydroxy-2-pyridinyl)carbamoylamino]-5-methyl-3-oxohexyl]-N-phenylmethoxyformamide |
| SMILES | CCCC[C@H](CN(C=O)OCc1ccccc1)C(=O)[C@@H](NC(=O)Nc1ncc(F)cc1O)C(C)C |
| InChI | InChI=1S/C25H33FN4O5/c1-4-5-11-19(14-30(16-31)35-15-18-9-7-6-8-10-18)23(33)22(17(2)3)28-25(34)29-24-21(32)12-20(26)13-27-24/h6-10,12-13,16-17,19,22,32H,4-5,11,14-15H2,1-3H3,(H2,27,28,29,34)/t19-,22+/m1/s1 |
| InChIKey | NAXMLBVTMDRUQW-KNQAVFIVSA-N |
| XLogP | 4.04 |
| TPSA | 120.86 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.56 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|