C38H46N6O10S2 — CID 142688421
N-[2-[(2-methoxyphenyl)methyl-[2-[(2-methoxyphenyl)methyl-[2-[(4-nitrophenyl)sulfonylamino]ethyl]amino]cyclohexyl]amino]ethyl]-4-nitrobenzenesulfonamide (PubChem CID 142688421) has the molecular formula C38H46N6O10S2 and a molecular weight of 810.95 g/mol. Its IUPAC name is N-[2-[(2-methoxyphenyl)methyl-[2-[(2-methoxyphenyl)methyl-[2-[(4-nitrophenyl)sulfonylamino]ethyl]amino]cyclohexyl]amino]ethyl]-4-nitrobenzenesulfonamide.
| Compound Name | N-[2-[(2-methoxyphenyl)methyl-[2-[(2-methoxyphenyl)methyl-[2-[(4-nitrophenyl)sulfonylamino]ethyl]amino]cyclohexyl]amino]ethyl]-4-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 142688421 |
| Molecular Formula | C38H46N6O10S2 |
| Molecular Weight | 810.95 g/mol |
| Exact Mass | 810.27 |
| IUPAC Name | N-[2-[(2-methoxyphenyl)methyl-[2-[(2-methoxyphenyl)methyl-[2-[(4-nitrophenyl)sulfonylamino]ethyl]amino]cyclohexyl]amino]ethyl]-4-nitrobenzenesulfonamide |
| SMILES | COc1ccccc1CN(CCNS(=O)(=O)c1ccc([N+](=O)[O-])cc1)C1CCCCC1N(CCNS(=O)(=O)c1ccc([N+](=O)[O-])cc1)Cc1ccccc1OC |
| InChI | InChI=1S/C38H46N6O10S2/c1-53-37-13-7-3-9-29(37)27-41(25-23-39-55(49,50)33-19-15-31(16-20-33)43(45)46)35-11-5-6-12-36(35)42(28-30-10-4-8-14-38(30)54-2)26-24-40-56(51,52)34-21-17-32(18-22-34)44(47)48/h3-4,7-10,13-22,35-36,39-40H,5-6,11-12,23-28H2,1-2H3 |
| InChIKey | UNHFLKYZMXNOSY-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 203.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 56 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 810.95 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|