C35H43F2N5O6 — CID 142688822
5-[[2-butyl-1-[[4-[2-methoxy-4-(2-methoxyethylcarbamoyl)phenoxy]phenyl]methyl]piperidin-4-yl]carbamoylamino]-2,4-difluorobenzamide (PubChem CID 142688822) has the molecular formula C35H43F2N5O6 and a molecular weight of 667.75 g/mol. Its IUPAC name is 5-[[2-butyl-1-[[4-[2-methoxy-4-(2-methoxyethylcarbamoyl)phenoxy]phenyl]methyl]piperidin-4-yl]carbamoylamino]-2,4-difluorobenzamide.
| Compound Name | 5-[[2-butyl-1-[[4-[2-methoxy-4-(2-methoxyethylcarbamoyl)phenoxy]phenyl]methyl]piperidin-4-yl]carbamoylamino]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 142688822 |
| Molecular Formula | C35H43F2N5O6 |
| Molecular Weight | 667.75 g/mol |
| Exact Mass | 667.32 |
| IUPAC Name | 5-[[2-butyl-1-[[4-[2-methoxy-4-(2-methoxyethylcarbamoyl)phenoxy]phenyl]methyl]piperidin-4-yl]carbamoylamino]-2,4-difluorobenzamide |
| SMILES | CCCCC1CC(NC(=O)Nc2cc(C(N)=O)c(F)cc2F)CCN1Cc1ccc(Oc2ccc(C(=O)NCCOC)cc2OC)cc1 |
| InChI | InChI=1S/C35H43F2N5O6/c1-4-5-6-25-18-24(40-35(45)41-30-19-27(33(38)43)28(36)20-29(30)37)13-15-42(25)21-22-7-10-26(11-8-22)48-31-12-9-23(17-32(31)47-3)34(44)39-14-16-46-2/h7-12,17,19-20,24-25H,4-6,13-16,18,21H2,1-3H3,(H2,38,43)(H,39,44)(H2,40,41,45) |
| InChIKey | UYELVYDJAVRAFH-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 144.25 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.75 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|