C16H10ClFO2S2 — CID 142689227
2-[2-(5-chlorothiophen-2-yl)-5-(4-fluorophenyl)thiophen-3-yl]acetic acid (PubChem CID 142689227) has the molecular formula C16H10ClFO2S2 and a molecular weight of 352.84 g/mol. Its IUPAC name is 2-[2-(5-chlorothiophen-2-yl)-5-(4-fluorophenyl)thiophen-3-yl]acetic acid.
| Compound Name | 2-[2-(5-chlorothiophen-2-yl)-5-(4-fluorophenyl)thiophen-3-yl]acetic acid |
|---|---|
| PubChem CID | 142689227 |
| Molecular Formula | C16H10ClFO2S2 |
| Molecular Weight | 352.84 g/mol |
| Exact Mass | 351.98 |
| IUPAC Name | 2-[2-(5-chlorothiophen-2-yl)-5-(4-fluorophenyl)thiophen-3-yl]acetic acid |
| SMILES | O=C(O)Cc1cc(-c2ccc(F)cc2)sc1-c1ccc(Cl)s1 |
| InChI | InChI=1S/C16H10ClFO2S2/c17-14-6-5-12(21-14)16-10(8-15(19)20)7-13(22-16)9-1-3-11(18)4-2-9/h1-7H,8H2,(H,19,20) |
| InChIKey | FCLFYIWZCYZFTJ-UHFFFAOYSA-N |
| XLogP | 5.56 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.84 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |