About sodium 2-[4-(5-chlorothiophen-2-yl)-2-(4-fluorophenyl)-1,3-oxazol-5-yl]acetate
sodium 2-[4-(5-chlorothiophen-2-yl)-2-(4-fluorophenyl)-1,3-oxazol-5-yl]acetate (PubChem CID 67547495) has the molecular formula C15H8ClFNNaO3S
and a molecular weight of 359.74 g/mol. Its IUPAC name is sodium 2-[4-(5-chlorothiophen-2-yl)-2-(4-fluorophenyl)-1,3-oxazol-5-yl]acetate.
Molecular Properties
| Compound Name | sodium 2-[4-(5-chlorothiophen-2-yl)-2-(4-fluorophenyl)-1,3-oxazol-5-yl]acetate |
| PubChem CID | 67547495 |
| Molecular Formula | C15H8ClFNNaO3S |
| Molecular Weight | 359.74 g/mol |
| Exact Mass | 358.98 |
| IUPAC Name | sodium 2-[4-(5-chlorothiophen-2-yl)-2-(4-fluorophenyl)-1,3-oxazol-5-yl]acetate |
| SMILES | O=C([O-])Cc1oc(-c2ccc(F)cc2)nc1-c1ccc(Cl)s1.[Na+] |
| InChI | InChI=1S/C15H9ClFNO3S.Na/c16-12-6-5-11(22-12)14-10(7-13(19)20)21-15(18-14)8-1-3-9(17)4-2-8;/h1-6H,7H2,(H,19,20);/q;+1/p-1 |
| InChIKey | JABAMRITPQMKOX-UHFFFAOYSA-M |
| XLogP | 0.16 |
| TPSA | 66.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 359.74 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze sodium 2-[4-(5-chlorothiophen-2-yl)-2-(4-fluorophenyl)-1,3-oxazol-5-yl]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 2-[4-(5-chlorothiophen-2-yl)-2-(4-fluorophenyl)-1,3-oxazol-5-yl]acetate?
The IUPAC name of sodium 2-[4-(5-chlorothiophen-2-yl)-2-(4-fluorophenyl)-1,3-oxazol-5-yl]acetate (CID 67547495) is sodium 2-[4-(5-chlorothiophen-2-yl)-2-(4-fluorophenyl)-1,3-oxazol-5-yl]acetate.
What is the SMILES notation for sodium 2-[4-(5-chlorothiophen-2-yl)-2-(4-fluorophenyl)-1,3-oxazol-5-yl]acetate?
The canonical SMILES for sodium 2-[4-(5-chlorothiophen-2-yl)-2-(4-fluorophenyl)-1,3-oxazol-5-yl]acetate is O=C([O-])Cc1oc(-c2ccc(F)cc2)nc1-c1ccc(Cl)s1.[Na+].
What is the InChIKey of sodium 2-[4-(5-chlorothiophen-2-yl)-2-(4-fluorophenyl)-1,3-oxazol-5-yl]acetate?
The InChIKey is JABAMRITPQMKOX-UHFFFAOYSA-M. The full InChI is InChI=1S/C15H9ClFNO3S.Na/c16-12-6-5-11(22-12)14-10(7-13(19)20)21-15(18-14)8-1-3-9(17)4-2-8;/h1-6H,7H2,(H,19,20);/q;+1/p-1.
What are the key properties of sodium 2-[4-(5-chlorothiophen-2-yl)-2-(4-fluorophenyl)-1,3-oxazol-5-yl]acetate?
sodium 2-[4-(5-chlorothiophen-2-yl)-2-(4-fluorophenyl)-1,3-oxazol-5-yl]acetate has a molecular weight of 359.74 g/mol, XLogP of 0.16, 4 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 2-[4-(5-chlorothiophen-2-yl)-2-(4-fluorophenyl)-1,3-oxazol-5-yl]acetate is sourced from PubChem (CID 67547495), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).