C18H13ClFNO3S — CID 67548736
[5-(5-chlorothiophen-2-yl)-2-(4-fluorophenyl)-1,3-oxazol-4-yl] 2-methylidenebutanoate (PubChem CID 67548736) has the molecular formula C18H13ClFNO3S and a molecular weight of 377.82 g/mol. Its IUPAC name is [5-(5-chlorothiophen-2-yl)-2-(4-fluorophenyl)-1,3-oxazol-4-yl] 2-methylidenebutanoate.
| Compound Name | [5-(5-chlorothiophen-2-yl)-2-(4-fluorophenyl)-1,3-oxazol-4-yl] 2-methylidenebutanoate |
|---|---|
| PubChem CID | 67548736 |
| Molecular Formula | C18H13ClFNO3S |
| Molecular Weight | 377.82 g/mol |
| Exact Mass | 377.03 |
| IUPAC Name | [5-(5-chlorothiophen-2-yl)-2-(4-fluorophenyl)-1,3-oxazol-4-yl] 2-methylidenebutanoate |
| SMILES | C=C(CC)C(=O)Oc1nc(-c2ccc(F)cc2)oc1-c1ccc(Cl)s1 |
| InChI | InChI=1S/C18H13ClFNO3S/c1-3-10(2)18(22)24-17-15(13-8-9-14(19)25-13)23-16(21-17)11-4-6-12(20)7-5-11/h4-9H,2-3H2,1H3 |
| InChIKey | MBFMWHISTVLSHF-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.82 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|