C17H14FNO3S — CID 67549415
[2-(4-fluorophenyl)-5-thiophen-3-yl-1,3-oxazol-4-yl] butanoate (PubChem CID 67549415) has the molecular formula C17H14FNO3S and a molecular weight of 331.37 g/mol. Its IUPAC name is [2-(4-fluorophenyl)-5-thiophen-3-yl-1,3-oxazol-4-yl] butanoate.
| Compound Name | [2-(4-fluorophenyl)-5-thiophen-3-yl-1,3-oxazol-4-yl] butanoate |
|---|---|
| PubChem CID | 67549415 |
| Molecular Formula | C17H14FNO3S |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.07 |
| IUPAC Name | [2-(4-fluorophenyl)-5-thiophen-3-yl-1,3-oxazol-4-yl] butanoate |
| SMILES | CCCC(=O)Oc1nc(-c2ccc(F)cc2)oc1-c1ccsc1 |
| InChI | InChI=1S/C17H14FNO3S/c1-2-3-14(20)21-17-15(12-8-9-23-10-12)22-16(19-17)11-4-6-13(18)7-5-11/h4-10H,2-3H2,1H3 |
| InChIKey | IZOCQOBMGHBOAS-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 52.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |