C19H16FNO4S — CID 59384959
ethyl 2-[2-(4-fluorophenyl)-5-(5-formyl-4-methylthiophen-2-yl)-1,3-oxazol-4-yl]acetate (PubChem CID 59384959) has the molecular formula C19H16FNO4S and a molecular weight of 373.41 g/mol. Its IUPAC name is ethyl 2-[2-(4-fluorophenyl)-5-(5-formyl-4-methylthiophen-2-yl)-1,3-oxazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-(4-fluorophenyl)-5-(5-formyl-4-methylthiophen-2-yl)-1,3-oxazol-4-yl]acetate |
|---|---|
| PubChem CID | 59384959 |
| Molecular Formula | C19H16FNO4S |
| Molecular Weight | 373.41 g/mol |
| Exact Mass | 373.08 |
| IUPAC Name | ethyl 2-[2-(4-fluorophenyl)-5-(5-formyl-4-methylthiophen-2-yl)-1,3-oxazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1nc(-c2ccc(F)cc2)oc1-c1cc(C)c(C=O)s1 |
| InChI | InChI=1S/C19H16FNO4S/c1-3-24-17(23)9-14-18(15-8-11(2)16(10-22)26-15)25-19(21-14)12-4-6-13(20)7-5-12/h4-8,10H,3,9H2,1-2H3 |
| InChIKey | WTOOCIANKLRPIL-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 69.40 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.41 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|