C21H15FN2O3 — CID 142178792
methyl 2-[2-(4-fluorophenyl)-5-quinolin-6-yl-1,3-oxazol-4-yl]acetate (PubChem CID 142178792) has the molecular formula C21H15FN2O3 and a molecular weight of 362.36 g/mol. Its IUPAC name is methyl 2-[2-(4-fluorophenyl)-5-quinolin-6-yl-1,3-oxazol-4-yl]acetate.
| Compound Name | methyl 2-[2-(4-fluorophenyl)-5-quinolin-6-yl-1,3-oxazol-4-yl]acetate |
|---|---|
| PubChem CID | 142178792 |
| Molecular Formula | C21H15FN2O3 |
| Molecular Weight | 362.36 g/mol |
| Exact Mass | 362.11 |
| IUPAC Name | methyl 2-[2-(4-fluorophenyl)-5-quinolin-6-yl-1,3-oxazol-4-yl]acetate |
| SMILES | COC(=O)Cc1nc(-c2ccc(F)cc2)oc1-c1ccc2ncccc2c1 |
| InChI | InChI=1S/C21H15FN2O3/c1-26-19(25)12-18-20(15-6-9-17-14(11-15)3-2-10-23-17)27-21(24-18)13-4-7-16(22)8-5-13/h2-11H,12H2,1H3 |
| InChIKey | IIMKTQPJVIWMJP-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.36 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |