C19H11FNO4- — CID 59384678
2-[5-(1-benzofuran-5-yl)-2-(4-fluorophenyl)-1,3-oxazol-4-yl]acetate (PubChem CID 59384678) has the molecular formula C19H11FNO4- and a molecular weight of 336.30 g/mol. Its IUPAC name is 2-[5-(1-benzofuran-5-yl)-2-(4-fluorophenyl)-1,3-oxazol-4-yl]acetate.
| Compound Name | 2-[5-(1-benzofuran-5-yl)-2-(4-fluorophenyl)-1,3-oxazol-4-yl]acetate |
|---|---|
| PubChem CID | 59384678 |
| Molecular Formula | C19H11FNO4- |
| Molecular Weight | 336.30 g/mol |
| Exact Mass | 336.07 |
| IUPAC Name | 2-[5-(1-benzofuran-5-yl)-2-(4-fluorophenyl)-1,3-oxazol-4-yl]acetate |
| SMILES | O=C([O-])Cc1nc(-c2ccc(F)cc2)oc1-c1ccc2occc2c1 |
| InChI | InChI=1S/C19H12FNO4/c20-14-4-1-11(2-5-14)19-21-15(10-17(22)23)18(25-19)13-3-6-16-12(9-13)7-8-24-16/h1-9H,10H2,(H,22,23)/p-1 |
| InChIKey | OEVBSDFCORJVJD-UHFFFAOYSA-M |
| XLogP | 3.19 |
| TPSA | 79.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.30 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |