C24H23N3O4 — CID 173333748
1-[3-(1-benzofuran-5-yl)-2-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]but-2-enyl]-1-hydroxyurea (PubChem CID 173333748) has the molecular formula C24H23N3O4 and a molecular weight of 417.47 g/mol. Its IUPAC name is 1-[3-(1-benzofuran-5-yl)-2-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]but-2-enyl]-1-hydroxyurea.
| Compound Name | 1-[3-(1-benzofuran-5-yl)-2-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]but-2-enyl]-1-hydroxyurea |
|---|---|
| PubChem CID | 173333748 |
| Molecular Formula | C24H23N3O4 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.17 |
| IUPAC Name | 1-[3-(1-benzofuran-5-yl)-2-[(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl]but-2-enyl]-1-hydroxyurea |
| SMILES | CC(=C(Cc1nc(-c2ccccc2)oc1C)CN(O)C(N)=O)c1ccc2occc2c1 |
| InChI | InChI=1S/C24H23N3O4/c1-15(18-8-9-22-19(12-18)10-11-30-22)20(14-27(29)24(25)28)13-21-16(2)31-23(26-21)17-6-4-3-5-7-17/h3-12,29H,13-14H2,1-2H3,(H2,25,28) |
| InChIKey | DSCBBBQGEZZCSG-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 105.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|