C16H13ClN2O3S — CID 59384723
ethyl 2-[2-(6-chloro-3-pyridinyl)-5-thiophen-2-yl-1,3-oxazol-4-yl]acetate (PubChem CID 59384723) has the molecular formula C16H13ClN2O3S and a molecular weight of 348.81 g/mol. Its IUPAC name is ethyl 2-[2-(6-chloro-3-pyridinyl)-5-thiophen-2-yl-1,3-oxazol-4-yl]acetate.
| Compound Name | ethyl 2-[2-(6-chloro-3-pyridinyl)-5-thiophen-2-yl-1,3-oxazol-4-yl]acetate |
|---|---|
| PubChem CID | 59384723 |
| Molecular Formula | C16H13ClN2O3S |
| Molecular Weight | 348.81 g/mol |
| Exact Mass | 348.03 |
| IUPAC Name | ethyl 2-[2-(6-chloro-3-pyridinyl)-5-thiophen-2-yl-1,3-oxazol-4-yl]acetate |
| SMILES | CCOC(=O)Cc1nc(-c2ccc(Cl)nc2)oc1-c1cccs1 |
| InChI | InChI=1S/C16H13ClN2O3S/c1-2-21-14(20)8-11-15(12-4-3-7-23-12)22-16(19-11)10-5-6-13(17)18-9-10/h3-7,9H,2,8H2,1H3 |
| InChIKey | VWDSTQZQSRHZIC-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.81 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|