C18H12N2O3S — CID 59384744
2-(2-isoquinolin-3-yl-5-thiophen-2-yl-1,3-oxazol-4-yl)acetic acid (PubChem CID 59384744) has the molecular formula C18H12N2O3S and a molecular weight of 336.37 g/mol. Its IUPAC name is 2-(2-isoquinolin-3-yl-5-thiophen-2-yl-1,3-oxazol-4-yl)acetic acid.
| Compound Name | 2-(2-isoquinolin-3-yl-5-thiophen-2-yl-1,3-oxazol-4-yl)acetic acid |
|---|---|
| PubChem CID | 59384744 |
| Molecular Formula | C18H12N2O3S |
| Molecular Weight | 336.37 g/mol |
| Exact Mass | 336.06 |
| IUPAC Name | 2-(2-isoquinolin-3-yl-5-thiophen-2-yl-1,3-oxazol-4-yl)acetic acid |
| SMILES | O=C(O)Cc1nc(-c2cc3ccccc3cn2)oc1-c1cccs1 |
| InChI | InChI=1S/C18H12N2O3S/c21-16(22)9-13-17(15-6-3-7-24-15)23-18(20-13)14-8-11-4-1-2-5-12(11)10-19-14/h1-8,10H,9H2,(H,21,22) |
| InChIKey | NPOIOGMAUQZYER-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 76.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.37 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |