C18H11N2O3S- — CID 59384743
2-(2-isoquinolin-3-yl-5-thiophen-2-yl-1,3-oxazol-4-yl)acetate (PubChem CID 59384743) has the molecular formula C18H11N2O3S- and a molecular weight of 335.36 g/mol. Its IUPAC name is 2-(2-isoquinolin-3-yl-5-thiophen-2-yl-1,3-oxazol-4-yl)acetate.
| Compound Name | 2-(2-isoquinolin-3-yl-5-thiophen-2-yl-1,3-oxazol-4-yl)acetate |
|---|---|
| PubChem CID | 59384743 |
| Molecular Formula | C18H11N2O3S- |
| Molecular Weight | 335.36 g/mol |
| Exact Mass | 335.05 |
| IUPAC Name | 2-(2-isoquinolin-3-yl-5-thiophen-2-yl-1,3-oxazol-4-yl)acetate |
| SMILES | O=C([O-])Cc1nc(-c2cc3ccccc3cn2)oc1-c1cccs1 |
| InChI | InChI=1S/C18H12N2O3S/c21-16(22)9-13-17(15-6-3-7-24-15)23-18(20-13)14-8-11-4-1-2-5-12(11)10-19-14/h1-8,10H,9H2,(H,21,22)/p-1 |
| InChIKey | NPOIOGMAUQZYER-UHFFFAOYSA-M |
| XLogP | 2.91 |
| TPSA | 79.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.36 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |