C12H11ClN2O3 — CID 174640185
[2-(6-chloro-3-pyridinyl)-5-methyl-1,3-oxazol-4-yl]methyl acetate (PubChem CID 174640185) has the molecular formula C12H11ClN2O3 and a molecular weight of 266.68 g/mol. Its IUPAC name is [2-(6-chloro-3-pyridinyl)-5-methyl-1,3-oxazol-4-yl]methyl acetate.
| Compound Name | [2-(6-chloro-3-pyridinyl)-5-methyl-1,3-oxazol-4-yl]methyl acetate |
|---|---|
| PubChem CID | 174640185 |
| Molecular Formula | C12H11ClN2O3 |
| Molecular Weight | 266.68 g/mol |
| Exact Mass | 266.05 |
| IUPAC Name | [2-(6-chloro-3-pyridinyl)-5-methyl-1,3-oxazol-4-yl]methyl acetate |
| SMILES | CC(=O)OCc1nc(-c2ccc(Cl)nc2)oc1C |
| InChI | InChI=1S/C12H11ClN2O3/c1-7-10(6-17-8(2)16)15-12(18-7)9-3-4-11(13)14-5-9/h3-5H,6H2,1-2H3 |
| InChIKey | DYJSBYTUJDKPPH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 65.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.68 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|