C26H21NO5 — CID 16588848
(5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl 4-(4-acetyloxyphenyl)benzoate (PubChem CID 16588848) has the molecular formula C26H21NO5 and a molecular weight of 427.46 g/mol. Its IUPAC name is (5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl 4-(4-acetyloxyphenyl)benzoate.
| Compound Name | (5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl 4-(4-acetyloxyphenyl)benzoate |
|---|---|
| PubChem CID | 16588848 |
| Molecular Formula | C26H21NO5 |
| Molecular Weight | 427.46 g/mol |
| Exact Mass | 427.14 |
| IUPAC Name | (5-methyl-2-phenyl-1,3-oxazol-4-yl)methyl 4-(4-acetyloxyphenyl)benzoate |
| SMILES | CC(=O)Oc1ccc(-c2ccc(C(=O)OCc3nc(-c4ccccc4)oc3C)cc2)cc1 |
| InChI | InChI=1S/C26H21NO5/c1-17-24(27-25(31-17)21-6-4-3-5-7-21)16-30-26(29)22-10-8-19(9-11-22)20-12-14-23(15-13-20)32-18(2)28/h3-15H,16H2,1-2H3 |
| InChIKey | CTDCWMYEUORSPP-UHFFFAOYSA-N |
| XLogP | 5.60 |
| TPSA | 78.63 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.46 |
| LogP ≤ 5 | 5.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|