C24H19N5O2 — CID 142689499
4-cyano-N-[(1R)-1-[(4-cyanobenzoyl)-pyridin-2-ylamino]propyl]benzamide (PubChem CID 142689499) has the molecular formula C24H19N5O2 and a molecular weight of 409.45 g/mol. Its IUPAC name is 4-cyano-N-[(1R)-1-[(4-cyanobenzoyl)-pyridin-2-ylamino]propyl]benzamide.
| Compound Name | 4-cyano-N-[(1R)-1-[(4-cyanobenzoyl)-pyridin-2-ylamino]propyl]benzamide |
|---|---|
| PubChem CID | 142689499 |
| Molecular Formula | C24H19N5O2 |
| Molecular Weight | 409.45 g/mol |
| Exact Mass | 409.15 |
| IUPAC Name | 4-cyano-N-[(1R)-1-[(4-cyanobenzoyl)-pyridin-2-ylamino]propyl]benzamide |
| SMILES | CC[C@H](NC(=O)c1ccc(C#N)cc1)N(C(=O)c1ccc(C#N)cc1)c1ccccn1 |
| InChI | InChI=1S/C24H19N5O2/c1-2-21(28-23(30)19-10-6-17(15-25)7-11-19)29(22-5-3-4-14-27-22)24(31)20-12-8-18(16-26)9-13-20/h3-14,21H,2H2,1H3,(H,28,30)/t21-/m1/s1 |
| InChIKey | WVXDGYBWXWXWMY-OAQYLSRUSA-N |
| XLogP | 3.64 |
| TPSA | 109.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|