About 1-(2,3-dichloropropoxy)hexane
1-(2,3-dichloropropoxy)hexane (PubChem CID 14269129) has the molecular formula C9H18Cl2O
and a molecular weight of 213.15 g/mol. Its IUPAC name is 1-(2,3-dichloropropoxy)hexane.
Molecular Properties
| Compound Name | 1-(2,3-dichloropropoxy)hexane |
| PubChem CID | 14269129 |
| Molecular Formula | C9H18Cl2O |
| Molecular Weight | 213.15 g/mol |
| Exact Mass | 212.07 |
| IUPAC Name | 1-(2,3-dichloropropoxy)hexane |
| SMILES | CCCCCCOCC(Cl)CCl |
| InChI | InChI=1S/C9H18Cl2O/c1-2-3-4-5-6-12-8-9(11)7-10/h9H,2-8H2,1H3 |
| InChIKey | RMLKNIRFKYWOMQ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 213.15 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(2,3-dichloropropoxy)hexane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(2,3-dichloropropoxy)hexane?
The IUPAC name of 1-(2,3-dichloropropoxy)hexane (CID 14269129) is 1-(2,3-dichloropropoxy)hexane.
What is the SMILES notation for 1-(2,3-dichloropropoxy)hexane?
The canonical SMILES for 1-(2,3-dichloropropoxy)hexane is CCCCCCOCC(Cl)CCl.
What is the InChIKey of 1-(2,3-dichloropropoxy)hexane?
The InChIKey is RMLKNIRFKYWOMQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H18Cl2O/c1-2-3-4-5-6-12-8-9(11)7-10/h9H,2-8H2,1H3.
What are the key properties of 1-(2,3-dichloropropoxy)hexane?
1-(2,3-dichloropropoxy)hexane has a molecular weight of 213.15 g/mol, XLogP of 3.43, 8 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(2,3-dichloropropoxy)hexane is sourced from PubChem (CID 14269129), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).