C27H37ClN4O2 — CID 142692872
N-[(3S)-1-[(3S,4R)-4-(4-chlorophenyl)-1-cyanopyrrolidine-3-carbonyl]pyrrolidin-3-yl]-2-methyl-N-(4-methylcyclohexyl)propanamide (PubChem CID 142692872) has the molecular formula C27H37ClN4O2 and a molecular weight of 485.07 g/mol. Its IUPAC name is N-[(3S)-1-[(3S,4R)-4-(4-chlorophenyl)-1-cyanopyrrolidine-3-carbonyl]pyrrolidin-3-yl]-2-methyl-N-(4-methylcyclohexyl)propanamide.
| Compound Name | N-[(3S)-1-[(3S,4R)-4-(4-chlorophenyl)-1-cyanopyrrolidine-3-carbonyl]pyrrolidin-3-yl]-2-methyl-N-(4-methylcyclohexyl)propanamide |
|---|---|
| PubChem CID | 142692872 |
| Molecular Formula | C27H37ClN4O2 |
| Molecular Weight | 485.07 g/mol |
| Exact Mass | 484.26 |
| IUPAC Name | N-[(3S)-1-[(3S,4R)-4-(4-chlorophenyl)-1-cyanopyrrolidine-3-carbonyl]pyrrolidin-3-yl]-2-methyl-N-(4-methylcyclohexyl)propanamide |
| SMILES | CC1CCC(N(C(=O)C(C)C)[C@H]2CCN(C(=O)[C@@H]3CN(C#N)C[C@H]3c3ccc(Cl)cc3)C2)CC1 |
| InChI | InChI=1S/C27H37ClN4O2/c1-18(2)26(33)32(22-10-4-19(3)5-11-22)23-12-13-31(14-23)27(34)25-16-30(17-29)15-24(25)20-6-8-21(28)9-7-20/h6-9,18-19,22-25H,4-5,10-16H2,1-3H3/t19?,22?,23-,24-,25+/m0/s1 |
| InChIKey | PGOZWNHNUUDWOK-SGYKDTCTSA-N |
| XLogP | 4.50 |
| TPSA | 67.65 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.07 |
| LogP ≤ 5 | 4.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|