C27H40ClN5O2 — CID 66970972
N-[(3S)-1-[(3S,4R)-1-carbamimidoyl-4-(4-chlorophenyl)pyrrolidine-3-carbonyl]pyrrolidin-3-yl]-2-methyl-N-(4-methylcyclohexyl)propanamide (PubChem CID 66970972) has the molecular formula C27H40ClN5O2 and a molecular weight of 502.10 g/mol. Its IUPAC name is N-[(3S)-1-[(3S,4R)-1-carbamimidoyl-4-(4-chlorophenyl)pyrrolidine-3-carbonyl]pyrrolidin-3-yl]-2-methyl-N-(4-methylcyclohexyl)propanamide.
| Compound Name | N-[(3S)-1-[(3S,4R)-1-carbamimidoyl-4-(4-chlorophenyl)pyrrolidine-3-carbonyl]pyrrolidin-3-yl]-2-methyl-N-(4-methylcyclohexyl)propanamide |
|---|---|
| PubChem CID | 66970972 |
| Molecular Formula | C27H40ClN5O2 |
| Molecular Weight | 502.10 g/mol |
| Exact Mass | 501.29 |
| IUPAC Name | N-[(3S)-1-[(3S,4R)-1-carbamimidoyl-4-(4-chlorophenyl)pyrrolidine-3-carbonyl]pyrrolidin-3-yl]-2-methyl-N-(4-methylcyclohexyl)propanamide |
| SMILES | [H]/N=C(\N)N1C[C@@H](C(=O)N2CC[C@H](N(C(=O)C(C)C)C3CCC(C)CC3)C2)[C@H](c2ccc(Cl)cc2)C1 |
| InChI | InChI=1S/C27H40ClN5O2/c1-17(2)25(34)33(21-10-4-18(3)5-11-21)22-12-13-31(14-22)26(35)24-16-32(27(29)30)15-23(24)19-6-8-20(28)9-7-19/h6-9,17-18,21-24H,4-5,10-16H2,1-3H3,(H3,29,30)/t18?,21?,22-,23-,24+/m0/s1 |
| InChIKey | OLUDSBOZUYCNHN-AXNGQORHSA-N |
| XLogP | 3.91 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 502.10 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|