C17H14BrNO3S — CID 142693830
ethyl 4-bromo-2-(phenoxymethyl)thieno[3,2-c]pyridine-7-carboxylate (PubChem CID 142693830) has the molecular formula C17H14BrNO3S and a molecular weight of 392.27 g/mol. Its IUPAC name is ethyl 4-bromo-2-(phenoxymethyl)thieno[3,2-c]pyridine-7-carboxylate.
| Compound Name | ethyl 4-bromo-2-(phenoxymethyl)thieno[3,2-c]pyridine-7-carboxylate |
|---|---|
| PubChem CID | 142693830 |
| Molecular Formula | C17H14BrNO3S |
| Molecular Weight | 392.27 g/mol |
| Exact Mass | 390.99 |
| IUPAC Name | ethyl 4-bromo-2-(phenoxymethyl)thieno[3,2-c]pyridine-7-carboxylate |
| SMILES | CCOC(=O)c1cnc(Br)c2cc(COc3ccccc3)sc12 |
| InChI | InChI=1S/C17H14BrNO3S/c1-2-21-17(20)14-9-19-16(18)13-8-12(23-15(13)14)10-22-11-6-4-3-5-7-11/h3-9H,2,10H2,1H3 |
| InChIKey | FKANGFOFMBQPIE-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 48.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.27 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|