C26H20N4O3S — CID 142693986
4-(3-aminophenyl)-1-(4-methylphenyl)sulfonyl-5-pyridin-3-ylpyrrolo[2,3-b]pyridine-3-carbaldehyde (PubChem CID 142693986) has the molecular formula C26H20N4O3S and a molecular weight of 468.54 g/mol. Its IUPAC name is 4-(3-aminophenyl)-1-(4-methylphenyl)sulfonyl-5-pyridin-3-ylpyrrolo[2,3-b]pyridine-3-carbaldehyde.
| Compound Name | 4-(3-aminophenyl)-1-(4-methylphenyl)sulfonyl-5-pyridin-3-ylpyrrolo[2,3-b]pyridine-3-carbaldehyde |
|---|---|
| PubChem CID | 142693986 |
| Molecular Formula | C26H20N4O3S |
| Molecular Weight | 468.54 g/mol |
| Exact Mass | 468.13 |
| IUPAC Name | 4-(3-aminophenyl)-1-(4-methylphenyl)sulfonyl-5-pyridin-3-ylpyrrolo[2,3-b]pyridine-3-carbaldehyde |
| SMILES | Cc1ccc(S(=O)(=O)n2cc(C=O)c3c(-c4cccc(N)c4)c(-c4cccnc4)cnc32)cc1 |
| InChI | InChI=1S/C26H20N4O3S/c1-17-7-9-22(10-8-17)34(32,33)30-15-20(16-31)25-24(18-4-2-6-21(27)12-18)23(14-29-26(25)30)19-5-3-11-28-13-19/h2-16H,27H2,1H3 |
| InChIKey | MXUZFQBTJMCNMF-UHFFFAOYSA-N |
| XLogP | 4.71 |
| TPSA | 107.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.54 |
| LogP ≤ 5 | 4.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|