C22H15FN4O2S — CID 58354613
12-fluoro-8-(4-methylphenyl)sulfonyl-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene (PubChem CID 58354613) has the molecular formula C22H15FN4O2S and a molecular weight of 418.45 g/mol. Its IUPAC name is 12-fluoro-8-(4-methylphenyl)sulfonyl-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene.
| Compound Name | 12-fluoro-8-(4-methylphenyl)sulfonyl-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
|---|---|
| PubChem CID | 58354613 |
| Molecular Formula | C22H15FN4O2S |
| Molecular Weight | 418.45 g/mol |
| Exact Mass | 418.09 |
| IUPAC Name | 12-fluoro-8-(4-methylphenyl)sulfonyl-4-pyridin-3-yl-5,8,10-triazatricyclo[7.4.0.02,7]trideca-1(9),2,4,6,10,12-hexaene |
| SMILES | Cc1ccc(S(=O)(=O)n2c3cnc(-c4cccnc4)cc3c3cc(F)cnc32)cc1 |
| InChI | InChI=1S/C22H15FN4O2S/c1-14-4-6-17(7-5-14)30(28,29)27-21-13-25-20(15-3-2-8-24-11-15)10-18(21)19-9-16(23)12-26-22(19)27/h2-13H,1H3 |
| InChIKey | XWSUEGXAFXHPLJ-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 77.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.45 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |