C52H74F2N4O4S2Sn2 — CID 159118409
tributyl-[5-fluoro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-2-yl]stannane (PubChem CID 159118409) has the molecular formula C52H74F2N4O4S2Sn2 and a molecular weight of 1158.74 g/mol. Its IUPAC name is tributyl-[5-fluoro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-2-yl]stannane.
| Compound Name | tributyl-[5-fluoro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-2-yl]stannane |
|---|---|
| PubChem CID | 159118409 |
| Molecular Formula | C52H74F2N4O4S2Sn2 |
| Molecular Weight | 1158.74 g/mol |
| Exact Mass | 1160.32 |
| IUPAC Name | tributyl-[5-fluoro-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-2-yl]stannane |
| SMILES | CCCC[Sn](CCCC)(CCCC)c1cc2cc(F)cnc2n1S(=O)(=O)c1ccc(C)cc1.CCCC[Sn](CCCC)(CCCC)c1cc2cc(F)cnc2n1S(=O)(=O)c1ccc(C)cc1 |
| InChI | InChI=1S/2C14H10FN2O2S.6C4H9.2Sn/c2*1-10-2-4-13(5-3-10)20(18,19)17-7-6-11-8-12(15)9-16-14(11)17;6*1-3-4-2;;/h2*2-6,8-9H,1H3;6*1,3-4H2,2H3;; |
| InChIKey | KFJJTTUZOBYJEB-UHFFFAOYSA-N |
| XLogP | 13.55 |
| TPSA | 103.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 24 |
| Heavy Atoms | 66 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1158.74 |
| LogP ≤ 5 | 13.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |