C21H17FN2O2S — CID 68951720
1-(benzenesulfonyl)-2-ethyl-5-(3-fluorophenyl)pyrrolo[2,3-b]pyridine (PubChem CID 68951720) has the molecular formula C21H17FN2O2S and a molecular weight of 380.44 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-2-ethyl-5-(3-fluorophenyl)pyrrolo[2,3-b]pyridine.
| Compound Name | 1-(benzenesulfonyl)-2-ethyl-5-(3-fluorophenyl)pyrrolo[2,3-b]pyridine |
|---|---|
| PubChem CID | 68951720 |
| Molecular Formula | C21H17FN2O2S |
| Molecular Weight | 380.44 g/mol |
| Exact Mass | 380.10 |
| IUPAC Name | 1-(benzenesulfonyl)-2-ethyl-5-(3-fluorophenyl)pyrrolo[2,3-b]pyridine |
| SMILES | CCc1cc2cc(-c3cccc(F)c3)cnc2n1S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C21H17FN2O2S/c1-2-19-13-16-11-17(15-7-6-8-18(22)12-15)14-23-21(16)24(19)27(25,26)20-9-4-3-5-10-20/h3-14H,2H2,1H3 |
| InChIKey | BVMIVRBJRIUOLJ-UHFFFAOYSA-N |
| XLogP | 4.64 |
| TPSA | 51.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.44 |
| LogP ≤ 5 | 4.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |