C25H21ClN2O3S — CID 143951072
4-[9-(benzenesulfonyl)-3-chloropyrido[2,3-b]indol-6-yl]phenol;ethane (PubChem CID 143951072) has the molecular formula C25H21ClN2O3S and a molecular weight of 464.97 g/mol. Its IUPAC name is 4-[9-(benzenesulfonyl)-3-chloropyrido[2,3-b]indol-6-yl]phenol;ethane.
| Compound Name | 4-[9-(benzenesulfonyl)-3-chloropyrido[2,3-b]indol-6-yl]phenol;ethane |
|---|---|
| PubChem CID | 143951072 |
| Molecular Formula | C25H21ClN2O3S |
| Molecular Weight | 464.97 g/mol |
| Exact Mass | 464.10 |
| IUPAC Name | 4-[9-(benzenesulfonyl)-3-chloropyrido[2,3-b]indol-6-yl]phenol;ethane |
| SMILES | CC.O=S(=O)(c1ccccc1)n1c2ccc(-c3ccc(O)cc3)cc2c2cc(Cl)cnc21 |
| InChI | InChI=1S/C23H15ClN2O3S.C2H6/c24-17-13-21-20-12-16(15-6-9-18(27)10-7-15)8-11-22(20)26(23(21)25-14-17)30(28,29)19-4-2-1-3-5-19;1-2/h1-14,27H;1-2H3 |
| InChIKey | KGEPHXWMXMRGEX-UHFFFAOYSA-N |
| XLogP | 6.48 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.97 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |