C28H25ClN2O3S — CID 143951058
9-(benzenesulfonyl)-3-chloro-6-[(E)-2-(4-methoxyphenyl)ethenyl]pyrido[2,3-b]indole;ethane (PubChem CID 143951058) has the molecular formula C28H25ClN2O3S and a molecular weight of 505.04 g/mol. Its IUPAC name is 9-(benzenesulfonyl)-3-chloro-6-[(E)-2-(4-methoxyphenyl)ethenyl]pyrido[2,3-b]indole;ethane.
| Compound Name | 9-(benzenesulfonyl)-3-chloro-6-[(E)-2-(4-methoxyphenyl)ethenyl]pyrido[2,3-b]indole;ethane |
|---|---|
| PubChem CID | 143951058 |
| Molecular Formula | C28H25ClN2O3S |
| Molecular Weight | 505.04 g/mol |
| Exact Mass | 504.13 |
| IUPAC Name | 9-(benzenesulfonyl)-3-chloro-6-[(E)-2-(4-methoxyphenyl)ethenyl]pyrido[2,3-b]indole;ethane |
| SMILES | CC.COc1ccc(/C=C/c2ccc3c(c2)c2cc(Cl)cnc2n3S(=O)(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C26H19ClN2O3S.C2H6/c1-32-21-12-9-18(10-13-21)7-8-19-11-14-25-23(15-19)24-16-20(27)17-28-26(24)29(25)33(30,31)22-5-3-2-4-6-22;1-2/h2-17H,1H3;1-2H3/b8-7+; |
| InChIKey | VBENXLSZDAGHIR-USRGLUTNSA-N |
| XLogP | 7.29 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.04 |
| LogP ≤ 5 | 7.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|