C29H28N2O3S — CID 66766255
9-(benzenesulfonyl)-6-(4-methoxyphenyl)-2-pentylpyrido[2,3-b]indole (PubChem CID 66766255) has the molecular formula C29H28N2O3S and a molecular weight of 484.62 g/mol. Its IUPAC name is 9-(benzenesulfonyl)-6-(4-methoxyphenyl)-2-pentylpyrido[2,3-b]indole.
| Compound Name | 9-(benzenesulfonyl)-6-(4-methoxyphenyl)-2-pentylpyrido[2,3-b]indole |
|---|---|
| PubChem CID | 66766255 |
| Molecular Formula | C29H28N2O3S |
| Molecular Weight | 484.62 g/mol |
| Exact Mass | 484.18 |
| IUPAC Name | 9-(benzenesulfonyl)-6-(4-methoxyphenyl)-2-pentylpyrido[2,3-b]indole |
| SMILES | CCCCCc1ccc2c3cc(-c4ccc(OC)cc4)ccc3n(S(=O)(=O)c3ccccc3)c2n1 |
| InChI | InChI=1S/C29H28N2O3S/c1-3-4-6-9-23-15-18-26-27-20-22(21-12-16-24(34-2)17-13-21)14-19-28(27)31(29(26)30-23)35(32,33)25-10-7-5-8-11-25/h5,7-8,10-20H,3-4,6,9H2,1-2H3 |
| InChIKey | VTKULWOJXMUVTQ-UHFFFAOYSA-N |
| XLogP | 6.83 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.62 |
| LogP ≤ 5 | 6.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|