C26H19ClN2O3S — CID 87141047
9-(benzenesulfonyl)-2-chloro-6-[1-(3-methoxyphenyl)ethenyl]pyrido[2,3-b]indole (PubChem CID 87141047) has the molecular formula C26H19ClN2O3S and a molecular weight of 474.97 g/mol. Its IUPAC name is 9-(benzenesulfonyl)-2-chloro-6-[1-(3-methoxyphenyl)ethenyl]pyrido[2,3-b]indole.
| Compound Name | 9-(benzenesulfonyl)-2-chloro-6-[1-(3-methoxyphenyl)ethenyl]pyrido[2,3-b]indole |
|---|---|
| PubChem CID | 87141047 |
| Molecular Formula | C26H19ClN2O3S |
| Molecular Weight | 474.97 g/mol |
| Exact Mass | 474.08 |
| IUPAC Name | 9-(benzenesulfonyl)-2-chloro-6-[1-(3-methoxyphenyl)ethenyl]pyrido[2,3-b]indole |
| SMILES | C=C(c1cccc(OC)c1)c1ccc2c(c1)c1ccc(Cl)nc1n2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C26H19ClN2O3S/c1-17(18-7-6-8-20(15-18)32-2)19-11-13-24-23(16-19)22-12-14-25(27)28-26(22)29(24)33(30,31)21-9-4-3-5-10-21/h3-16H,1H2,2H3 |
| InChIKey | OGXDMKKBEUKIAZ-UHFFFAOYSA-N |
| XLogP | 6.15 |
| TPSA | 61.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.97 |
| LogP ≤ 5 | 6.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|