C23H14ClN3O4S — CID 46186443
9-(benzenesulfonyl)-2-chloro-6-(3-nitrophenyl)pyrido[2,3-b]indole (PubChem CID 46186443) has the molecular formula C23H14ClN3O4S and a molecular weight of 463.90 g/mol. Its IUPAC name is 9-(benzenesulfonyl)-2-chloro-6-(3-nitrophenyl)pyrido[2,3-b]indole.
| Compound Name | 9-(benzenesulfonyl)-2-chloro-6-(3-nitrophenyl)pyrido[2,3-b]indole |
|---|---|
| PubChem CID | 46186443 |
| Molecular Formula | C23H14ClN3O4S |
| Molecular Weight | 463.90 g/mol |
| Exact Mass | 463.04 |
| IUPAC Name | 9-(benzenesulfonyl)-2-chloro-6-(3-nitrophenyl)pyrido[2,3-b]indole |
| SMILES | O=[N+]([O-])c1cccc(-c2ccc3c(c2)c2ccc(Cl)nc2n3S(=O)(=O)c2ccccc2)c1 |
| InChI | InChI=1S/C23H14ClN3O4S/c24-22-12-10-19-20-14-16(15-5-4-6-17(13-15)27(28)29)9-11-21(20)26(23(19)25-22)32(30,31)18-7-2-1-3-8-18/h1-14H |
| InChIKey | HKGCKIYILVJRKE-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 95.10 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.90 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|