C35H28N2O4S — CID 68735872
9-(benzenesulfonyl)-2,6-bis[1-(3-methoxyphenyl)ethenyl]pyrido[2,3-b]indole (PubChem CID 68735872) has the molecular formula C35H28N2O4S and a molecular weight of 572.69 g/mol. Its IUPAC name is 9-(benzenesulfonyl)-2,6-bis[1-(3-methoxyphenyl)ethenyl]pyrido[2,3-b]indole.
| Compound Name | 9-(benzenesulfonyl)-2,6-bis[1-(3-methoxyphenyl)ethenyl]pyrido[2,3-b]indole |
|---|---|
| PubChem CID | 68735872 |
| Molecular Formula | C35H28N2O4S |
| Molecular Weight | 572.69 g/mol |
| Exact Mass | 572.18 |
| IUPAC Name | 9-(benzenesulfonyl)-2,6-bis[1-(3-methoxyphenyl)ethenyl]pyrido[2,3-b]indole |
| SMILES | C=C(c1cccc(OC)c1)c1ccc2c(c1)c1ccc(C(=C)c3cccc(OC)c3)nc1n2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C35H28N2O4S/c1-23(25-10-8-12-28(20-25)40-3)27-16-19-34-32(22-27)31-17-18-33(24(2)26-11-9-13-29(21-26)41-4)36-35(31)37(34)42(38,39)30-14-6-5-7-15-30/h5-22H,1-2H2,3-4H3 |
| InChIKey | KYLPVHUCUYTKAA-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.69 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |