About 9-(benzenesulfonyl)-2,6-bis[1-(3-methoxyphenyl)ethenyl]pyrido[2,3-b]indole
9-(benzenesulfonyl)-2,6-bis[1-(3-methoxyphenyl)ethenyl]pyrido[2,3-b]indole (PubChem CID 68735872) has the molecular formula C35H28N2O4S
and a molecular weight of 572.69 g/mol. Its IUPAC name is 9-(benzenesulfonyl)-2,6-bis[1-(3-methoxyphenyl)ethenyl]pyrido[2,3-b]indole.
Molecular Properties
| Compound Name | 9-(benzenesulfonyl)-2,6-bis[1-(3-methoxyphenyl)ethenyl]pyrido[2,3-b]indole |
| PubChem CID | 68735872 |
| Molecular Formula | C35H28N2O4S |
| Molecular Weight | 572.69 g/mol |
| Exact Mass | 572.18 |
| IUPAC Name | 9-(benzenesulfonyl)-2,6-bis[1-(3-methoxyphenyl)ethenyl]pyrido[2,3-b]indole |
| SMILES | C=C(c1cccc(OC)c1)c1ccc2c(c1)c1ccc(C(=C)c3cccc(OC)c3)nc1n2S(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C35H28N2O4S/c1-23(25-10-8-12-28(20-25)40-3)27-16-19-34-32(22-27)31-17-18-33(24(2)26-11-9-13-29(21-26)41-4)36-35(31)37(34)42(38,39)30-14-6-5-7-15-30/h5-22H,1-2H2,3-4H3 |
| InChIKey | KYLPVHUCUYTKAA-UHFFFAOYSA-N |
| XLogP | 7.57 |
| TPSA | 70.42 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 572.69 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 9-(benzenesulfonyl)-2,6-bis[1-(3-methoxyphenyl)ethenyl]pyrido[2,3-b]indole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-(benzenesulfonyl)-2,6-bis[1-(3-methoxyphenyl)ethenyl]pyrido[2,3-b]indole?
The IUPAC name of 9-(benzenesulfonyl)-2,6-bis[1-(3-methoxyphenyl)ethenyl]pyrido[2,3-b]indole (CID 68735872) is 9-(benzenesulfonyl)-2,6-bis[1-(3-methoxyphenyl)ethenyl]pyrido[2,3-b]indole.
What is the SMILES notation for 9-(benzenesulfonyl)-2,6-bis[1-(3-methoxyphenyl)ethenyl]pyrido[2,3-b]indole?
The canonical SMILES for 9-(benzenesulfonyl)-2,6-bis[1-(3-methoxyphenyl)ethenyl]pyrido[2,3-b]indole is C=C(c1cccc(OC)c1)c1ccc2c(c1)c1ccc(C(=C)c3cccc(OC)c3)nc1n2S(=O)(=O)c1ccccc1.
What is the InChIKey of 9-(benzenesulfonyl)-2,6-bis[1-(3-methoxyphenyl)ethenyl]pyrido[2,3-b]indole?
The InChIKey is KYLPVHUCUYTKAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C35H28N2O4S/c1-23(25-10-8-12-28(20-25)40-3)27-16-19-34-32(22-27)31-17-18-33(24(2)26-11-9-13-29(21-26)41-4)36-35(31)37(34)42(38,39)30-14-6-5-7-15-30/h5-22H,1-2H2,3-4H3.
What are the key properties of 9-(benzenesulfonyl)-2,6-bis[1-(3-methoxyphenyl)ethenyl]pyrido[2,3-b]indole?
9-(benzenesulfonyl)-2,6-bis[1-(3-methoxyphenyl)ethenyl]pyrido[2,3-b]indole has a molecular weight of 572.69 g/mol, XLogP of 7.57, 8 rotatable bonds, 0 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 9-(benzenesulfonyl)-2,6-bis[1-(3-methoxyphenyl)ethenyl]pyrido[2,3-b]indole is sourced from PubChem (CID 68735872), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).