C25H22BrNO4S — CID 10097907
1-(benzenesulfonyl)-3-(bromomethyl)-2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]indole (PubChem CID 10097907) has the molecular formula C25H22BrNO4S and a molecular weight of 512.43 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-3-(bromomethyl)-2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]indole.
| Compound Name | 1-(benzenesulfonyl)-3-(bromomethyl)-2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]indole |
|---|---|
| PubChem CID | 10097907 |
| Molecular Formula | C25H22BrNO4S |
| Molecular Weight | 512.43 g/mol |
| Exact Mass | 511.05 |
| IUPAC Name | 1-(benzenesulfonyl)-3-(bromomethyl)-2-[(E)-2-(3,4-dimethoxyphenyl)ethenyl]indole |
| SMILES | COc1ccc(/C=C/c2c(CBr)c3ccccc3n2S(=O)(=O)c2ccccc2)cc1OC |
| InChI | InChI=1S/C25H22BrNO4S/c1-30-24-15-13-18(16-25(24)31-2)12-14-23-21(17-26)20-10-6-7-11-22(20)27(23)32(28,29)19-8-4-3-5-9-19/h3-16H,17H2,1-2H3/b14-12+ |
| InChIKey | NUVGCUYVLBXPQN-WYMLVPIESA-N |
| XLogP | 5.96 |
| TPSA | 57.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.43 |
| LogP ≤ 5 | 5.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|