C25H20N2O7S — CID 11504146
1-(benzenesulfonyl)-2-[(E)-2-(4,5-dimethoxy-2-nitrophenyl)ethenyl]indole-3-carbaldehyde (PubChem CID 11504146) has the molecular formula C25H20N2O7S and a molecular weight of 492.51 g/mol. Its IUPAC name is 1-(benzenesulfonyl)-2-[(E)-2-(4,5-dimethoxy-2-nitrophenyl)ethenyl]indole-3-carbaldehyde.
| Compound Name | 1-(benzenesulfonyl)-2-[(E)-2-(4,5-dimethoxy-2-nitrophenyl)ethenyl]indole-3-carbaldehyde |
|---|---|
| PubChem CID | 11504146 |
| Molecular Formula | C25H20N2O7S |
| Molecular Weight | 492.51 g/mol |
| Exact Mass | 492.10 |
| IUPAC Name | 1-(benzenesulfonyl)-2-[(E)-2-(4,5-dimethoxy-2-nitrophenyl)ethenyl]indole-3-carbaldehyde |
| SMILES | COc1cc(/C=C/c2c(C=O)c3ccccc3n2S(=O)(=O)c2ccccc2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C25H20N2O7S/c1-33-24-14-17(23(27(29)30)15-25(24)34-2)12-13-22-20(16-28)19-10-6-7-11-21(19)26(22)35(31,32)18-8-4-3-5-9-18/h3-16H,1-2H3/b13-12+ |
| InChIKey | DIELARSBPIMYLT-OUKQBFOZSA-N |
| XLogP | 4.79 |
| TPSA | 117.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.51 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|