C27H20N2O7S — CID 10324248
(E)-4-[1-(benzenesulfonyl)-2-[(E)-2-(6-nitro-1,3-benzodioxol-5-yl)ethenyl]indol-3-yl]but-3-en-2-one (PubChem CID 10324248) has the molecular formula C27H20N2O7S and a molecular weight of 516.53 g/mol. Its IUPAC name is (E)-4-[1-(benzenesulfonyl)-2-[(E)-2-(6-nitro-1,3-benzodioxol-5-yl)ethenyl]indol-3-yl]but-3-en-2-one.
| Compound Name | (E)-4-[1-(benzenesulfonyl)-2-[(E)-2-(6-nitro-1,3-benzodioxol-5-yl)ethenyl]indol-3-yl]but-3-en-2-one |
|---|---|
| PubChem CID | 10324248 |
| Molecular Formula | C27H20N2O7S |
| Molecular Weight | 516.53 g/mol |
| Exact Mass | 516.10 |
| IUPAC Name | (E)-4-[1-(benzenesulfonyl)-2-[(E)-2-(6-nitro-1,3-benzodioxol-5-yl)ethenyl]indol-3-yl]but-3-en-2-one |
| SMILES | CC(=O)/C=C/c1c(/C=C/c2cc3c(cc2[N+](=O)[O-])OCO3)n(S(=O)(=O)c2ccccc2)c2ccccc12 |
| InChI | InChI=1S/C27H20N2O7S/c1-18(30)11-13-22-21-9-5-6-10-23(21)28(37(33,34)20-7-3-2-4-8-20)24(22)14-12-19-15-26-27(36-17-35-26)16-25(19)29(31)32/h2-16H,17H2,1H3/b13-11+,14-12+ |
| InChIKey | SCGXGWNLNCBYDD-PHEQNACWSA-N |
| XLogP | 5.29 |
| TPSA | 117.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.53 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|