C29H24N2O9S — CID 10460787
ethyl (E)-3-[1-(benzenesulfonyl)-5-methoxy-2-[(E)-2-(6-nitro-1,3-benzodioxol-5-yl)ethenyl]indol-3-yl]prop-2-enoate (PubChem CID 10460787) has the molecular formula C29H24N2O9S and a molecular weight of 576.58 g/mol. Its IUPAC name is ethyl (E)-3-[1-(benzenesulfonyl)-5-methoxy-2-[(E)-2-(6-nitro-1,3-benzodioxol-5-yl)ethenyl]indol-3-yl]prop-2-enoate.
| Compound Name | ethyl (E)-3-[1-(benzenesulfonyl)-5-methoxy-2-[(E)-2-(6-nitro-1,3-benzodioxol-5-yl)ethenyl]indol-3-yl]prop-2-enoate |
|---|---|
| PubChem CID | 10460787 |
| Molecular Formula | C29H24N2O9S |
| Molecular Weight | 576.58 g/mol |
| Exact Mass | 576.12 |
| IUPAC Name | ethyl (E)-3-[1-(benzenesulfonyl)-5-methoxy-2-[(E)-2-(6-nitro-1,3-benzodioxol-5-yl)ethenyl]indol-3-yl]prop-2-enoate |
| SMILES | CCOC(=O)/C=C/c1c(/C=C/c2cc3c(cc2[N+](=O)[O-])OCO3)n(S(=O)(=O)c2ccccc2)c2ccc(OC)cc12 |
| InChI | InChI=1S/C29H24N2O9S/c1-3-38-29(32)14-11-22-23-16-20(37-2)10-13-25(23)30(41(35,36)21-7-5-4-6-8-21)24(22)12-9-19-15-27-28(40-18-39-27)17-26(19)31(33)34/h4-17H,3,18H2,1-2H3/b12-9+,14-11+ |
| InChIKey | HVNACJOECPAHCG-JZAGDRGGSA-N |
| XLogP | 5.27 |
| TPSA | 136.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.58 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|