C28H23N3O7S — CID 25223014
[1-(benzenesulfonyl)-2-methylindol-3-yl]-[4-(4,5-dimethoxy-2-nitrophenyl)-1H-pyrrol-3-yl]methanone (PubChem CID 25223014) has the molecular formula C28H23N3O7S and a molecular weight of 545.57 g/mol. Its IUPAC name is [1-(benzenesulfonyl)-2-methylindol-3-yl]-[4-(4,5-dimethoxy-2-nitrophenyl)-1H-pyrrol-3-yl]methanone.
| Compound Name | [1-(benzenesulfonyl)-2-methylindol-3-yl]-[4-(4,5-dimethoxy-2-nitrophenyl)-1H-pyrrol-3-yl]methanone |
|---|---|
| PubChem CID | 25223014 |
| Molecular Formula | C28H23N3O7S |
| Molecular Weight | 545.57 g/mol |
| Exact Mass | 545.13 |
| IUPAC Name | [1-(benzenesulfonyl)-2-methylindol-3-yl]-[4-(4,5-dimethoxy-2-nitrophenyl)-1H-pyrrol-3-yl]methanone |
| SMILES | COc1cc(-c2c[nH]cc2C(=O)c2c(C)n(S(=O)(=O)c3ccccc3)c3ccccc23)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C28H23N3O7S/c1-17-27(19-11-7-8-12-23(19)30(17)39(35,36)18-9-5-4-6-10-18)28(32)22-16-29-15-21(22)20-13-25(37-2)26(38-3)14-24(20)31(33)34/h4-16,29H,1-3H3 |
| InChIKey | DDMKITAJNDBYAJ-UHFFFAOYSA-N |
| XLogP | 5.34 |
| TPSA | 133.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.57 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|