C31H30N2O10S — CID 135024182
diethyl 2-[[2-(3,4-dimethoxyphenyl)-1-(4-methylphenyl)sulfonyl-5-nitroindol-3-yl]methylidene]propanedioate (PubChem CID 135024182) has the molecular formula C31H30N2O10S and a molecular weight of 622.65 g/mol. Its IUPAC name is diethyl 2-[[2-(3,4-dimethoxyphenyl)-1-(4-methylphenyl)sulfonyl-5-nitroindol-3-yl]methylidene]propanedioate.
| Compound Name | diethyl 2-[[2-(3,4-dimethoxyphenyl)-1-(4-methylphenyl)sulfonyl-5-nitroindol-3-yl]methylidene]propanedioate |
|---|---|
| PubChem CID | 135024182 |
| Molecular Formula | C31H30N2O10S |
| Molecular Weight | 622.65 g/mol |
| Exact Mass | 622.16 |
| IUPAC Name | diethyl 2-[[2-(3,4-dimethoxyphenyl)-1-(4-methylphenyl)sulfonyl-5-nitroindol-3-yl]methylidene]propanedioate |
| SMILES | CCOC(=O)C(=Cc1c(-c2ccc(OC)c(OC)c2)n(S(=O)(=O)c2ccc(C)cc2)c2ccc([N+](=O)[O-])cc12)C(=O)OCC |
| InChI | InChI=1S/C31H30N2O10S/c1-6-42-30(34)25(31(35)43-7-2)18-24-23-17-21(33(36)37)11-14-26(23)32(44(38,39)22-12-8-19(3)9-13-22)29(24)20-10-15-27(40-4)28(16-20)41-5/h8-18H,6-7H2,1-5H3 |
| InChIKey | FUDICDSXPDZTFX-UHFFFAOYSA-N |
| XLogP | 5.29 |
| TPSA | 153.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 622.65 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|