C17H16N4O6S — CID 46257909
3-(3,4-dimethoxyphenyl)-1-(4-nitrophenyl)sulfonylpyrazol-5-amine (PubChem CID 46257909) has the molecular formula C17H16N4O6S and a molecular weight of 404.40 g/mol. Its IUPAC name is 3-(3,4-dimethoxyphenyl)-1-(4-nitrophenyl)sulfonylpyrazol-5-amine.
| Compound Name | 3-(3,4-dimethoxyphenyl)-1-(4-nitrophenyl)sulfonylpyrazol-5-amine |
|---|---|
| PubChem CID | 46257909 |
| Molecular Formula | C17H16N4O6S |
| Molecular Weight | 404.40 g/mol |
| Exact Mass | 404.08 |
| IUPAC Name | 3-(3,4-dimethoxyphenyl)-1-(4-nitrophenyl)sulfonylpyrazol-5-amine |
| SMILES | COc1ccc(-c2cc(N)n(S(=O)(=O)c3ccc([N+](=O)[O-])cc3)n2)cc1OC |
| InChI | InChI=1S/C17H16N4O6S/c1-26-15-8-3-11(9-16(15)27-2)14-10-17(18)20(19-14)28(24,25)13-6-4-12(5-7-13)21(22)23/h3-10H,18H2,1-2H3 |
| InChIKey | LTWVPWVHMZORKD-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 139.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.40 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|